Products 69316-08-1
CAS 69316-08-1 appears in our catalog under these names: Methyl 4-(cyanoacetyl)benzoate, 96%, Methyl 4-(cyanoacetyl)benzoate, 95%, Methyl 4-(cyanoacetyl)benzoate, 98%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 100mg.
Methyl 4-(2-cyanoacetyl)benzoate (CAS 69316-08-1) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: methyl 4-(2-cyanoacetyl)benzoate. InChIKey: CTZGTFNYYYZXTE-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | methyl 4-(2-cyanoacetyl)benzoate |
| InChIKey | CTZGTFNYYYZXTE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C(=O)CC#N |
Computed by PubChem (NCBI)