Products 693268-77-8
CAS 693268-77-8 is the registry number for ChEs/MAOs-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(2-hydroxyphenyl)quinoline-8-sulfonamide (CAS 693268-77-8) is a chemical compound with the molecular formula C15H12N2O3S and a molecular weight of 300.3 g/mol. IUPAC name: N-(2-hydroxyphenyl)quinoline-8-sulfonamide. InChIKey: PYRLHQVUJQRPHS-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O3S |
|---|---|
| Molecular weight | 300.3 g/mol |
| IUPAC name | N-(2-hydroxyphenyl)quinoline-8-sulfonamide |
| InChIKey | PYRLHQVUJQRPHS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NS(=O)(=O)C2=CC=CC3=C2N=CC=C3)O |
Computed by PubChem (NCBI)