Products 69338-03-0
CAS 69338-03-0 is the registry number for α-Ethyl-6-methoxy-α-methyl-2-naphthalenemethanol, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(6-methoxynaphthalen-2-yl)butan-2-ol (CAS 69338-03-0) is a chemical compound with the molecular formula C15H18O2 and a molecular weight of 230.30 g/mol. IUPAC name: 2-(6-methoxynaphthalen-2-yl)butan-2-ol. InChIKey: LEWKWYZGBIUVEZ-UHFFFAOYSA-N.
| Molecular formula | C15H18O2 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | 2-(6-methoxynaphthalen-2-yl)butan-2-ol |
| InChIKey | LEWKWYZGBIUVEZ-UHFFFAOYSA-N |
| SMILES | CCC(C)(C1=CC2=C(C=C1)C=C(C=C2)OC)O |
Computed by PubChem (NCBI)