CAS 69355-99-3 appears in our catalog under these names: Boc–D–Thr(Bzl)–OH, Boc-D-Thr(Bzl)-OH, Boc-D-Thr(Bzl)-OH 98%, Boc-D-Thr(Bzl)-OH, 98%, 98%, Boc-D-Thr(Bzl)-OH, 98.0%. Offered by: GLPBio, Iris Biotech, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 25g, 5g, 1g, 250mg, 100mg, 5 g, 10 g.
(2R,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxybutanoic acid (CAS 69355-99-3) is a chemical compound with the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. IUPAC name: (2R,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxybutanoic acid. InChIKey: CTXPLTPDOISPTE-WCQYABFASA-N.
| Molecular formula | C16H23NO5 |
|---|---|
| Molecular weight | 309.36 g/mol |
| IUPAC name | (2R,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxybutanoic acid |
| InChIKey | CTXPLTPDOISPTE-WCQYABFASA-N |
| SMILES | C[C@@H]([C@H](C(=O)O)NC(=O)OC(C)(C)C)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)