CAS 69489-37-8 appears in our catalog under these names: 5-(4-Methylphenyl)imidazolidine-2,4-dione, 95%, Hydantoin Impurity 1, 5-(4-methylphenyl)imidazolidine-2,4-dione, >95% (HPLC), 5-(4-Methylphenyl)hydantoin, 5-(p-Tolyl)imidazolidine-2,4-dione 97%. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, Ambeed. Available pack sizes: 10g, 5g, 250mg, 1g, on request, 100mg, 500mg, 25mg.
5-(4-methylphenyl)imidazolidine-2,4-dione (CAS 69489-37-8) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 5-(4-methylphenyl)imidazolidine-2,4-dione. InChIKey: CSJOIZOYRMNZDL-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 5-(4-methylphenyl)imidazolidine-2,4-dione |
| InChIKey | CSJOIZOYRMNZDL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)