CAS 695149-42-9 is the registry number for (S)–3–Amino–3–(3–hydroxyphenyl)propanoic acid. Offered by: GLPBio. Available pack sizes: 100mg.
(3S)-3-amino-3-(3-hydroxyphenyl)propanoic acid (CAS 695149-42-9) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: (3S)-3-amino-3-(3-hydroxyphenyl)propanoic acid. InChIKey: NYHNEKBZZXSUNO-QMMMGPOBSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | (3S)-3-amino-3-(3-hydroxyphenyl)propanoic acid |
| InChIKey | NYHNEKBZZXSUNO-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC(=C1)O)[C@H](CC(=O)O)N |
Computed by PubChem (NCBI)