CAS 6956-82-7 appears in our catalog under these names: 2-(4-Bromo-2-methylphenoxy)acetic acid, 97%, 2-(4-Bromo-2-methylphenoxy)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-(4-bromo-2-methylphenoxy)acetic acid (CAS 6956-82-7) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: 2-(4-bromo-2-methylphenoxy)acetic acid. InChIKey: RPRFEMOMSGWISD-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | 2-(4-bromo-2-methylphenoxy)acetic acid |
| InChIKey | RPRFEMOMSGWISD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Br)OCC(=O)O |
Computed by PubChem (NCBI)