CAS 6965-69-1 appears in our catalog under these names: 2–(2–Formyl–4–nitrophenoxy)acetic acid, 2-(2-Formyl-4-nitrophenoxy)acetic acid 97%, Acetic acid,2-(2-formyl-4-nitrophenoxy)-, 98%, 98%, 2-Formyl-4-nitrophenoxyacetic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg.
2-(2-formyl-4-nitrophenoxy)acetic acid (CAS 6965-69-1) is a chemical compound with the molecular formula C9H7NO6 and a molecular weight of 225.15 g/mol. IUPAC name: 2-(2-formyl-4-nitrophenoxy)acetic acid. InChIKey: SQXGTZOQJSQCPQ-UHFFFAOYSA-N.
| Molecular formula | C9H7NO6 |
|---|---|
| Molecular weight | 225.15 g/mol |
| IUPAC name | 2-(2-formyl-4-nitrophenoxy)acetic acid |
| InChIKey | SQXGTZOQJSQCPQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C=O)OCC(=O)O |
Computed by PubChem (NCBI)