CAS 697235-49-7 appears in our catalog under these names: Dihydro Avenanthramide D, Hydroxyphenyl propamidobenzoic acid, 2-(3-(4-Hydroxyphenyl)propanamido)benzoic acid 97%, Dihydroavenanthramide D, 97%, 97%, 2-[[3-(4-HYDROXYPHENYL)-1-OXOPROPYL]AMINO]BENZOIC ACID, 98%. Offered by: Chemat Brand, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 100g, 25g, 5g.
2-[3-(4-hydroxyphenyl)propanoylamino]benzoic acid (CAS 697235-49-7) is a chemical compound with the molecular formula C16H15NO4 and a molecular weight of 285.29 g/mol. IUPAC name: 2-[3-(4-hydroxyphenyl)propanoylamino]benzoic acid. InChIKey: DLFOKZQWYFNKCL-UHFFFAOYSA-N.
| Molecular formula | C16H15NO4 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | 2-[3-(4-hydroxyphenyl)propanoylamino]benzoic acid |
| InChIKey | DLFOKZQWYFNKCL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NC(=O)CCC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)