CAS 69736-76-1 appears in our catalog under these names: 5-Bromo-1-ethylindoline-2,3-dione, 97%, 5-Bromo-1-ethylindoline-2,3-dione, 95%, 95%, 5-Bromo-1-ethyl-2,3-dihydro-1h-indole-2,3-dione, 95%, 5-Bromo-1-ethyl-2,3-dihydro-1H-indole-2,3-dione. Offered by: AmBeed, Chemat, Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 100mg, 250mg, 1g, 2,5g.
5-bromo-1-ethylindole-2,3-dione (CAS 69736-76-1) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: 5-bromo-1-ethylindole-2,3-dione. InChIKey: HKVOCQYGIYOURF-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 5-bromo-1-ethylindole-2,3-dione |
| InChIKey | HKVOCQYGIYOURF-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)Br)C(=O)C1=O |
Computed by PubChem (NCBI)