Products 782480-99-3

CAS 782480-99-3 is the registry number for 2-(2-(3-Chlorophenoxy)acetamido)benzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2-[[2-(3-chlorophenoxy)acetyl]amino]benzoic acid (CAS 782480-99-3) is a chemical compound with the molecular formula C15H12ClNO4 and a molecular weight of 305.71 g/mol. IUPAC name: 2-[[2-(3-chlorophenoxy)acetyl]amino]benzoic acid. InChIKey: QCZZSTBPSZAAMG-UHFFFAOYSA-N.

Identity
Molecular formulaC15H12ClNO4
Molecular weight305.71 g/mol
IUPAC name2-[[2-(3-chlorophenoxy)acetyl]amino]benzoic acid
InChIKeyQCZZSTBPSZAAMG-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)O)NC(=O)COC2=CC(=CC=C2)Cl

Computed by PubChem (NCBI)