Products 698356-46-6
CAS 698356-46-6 is the registry number for ETHYL 5-BROMO-2,6-DIMETHYLNICOTINATE, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Ethyl 5-bromo-2,6-dimethylpyridine-3-carboxylate (CAS 698356-46-6) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: ethyl 5-bromo-2,6-dimethylpyridine-3-carboxylate. InChIKey: HKWNMDYFLCCFMO-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | ethyl 5-bromo-2,6-dimethylpyridine-3-carboxylate |
| InChIKey | HKWNMDYFLCCFMO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(N=C1C)C)Br |
Computed by PubChem (NCBI)