Products 69853-46-9
CAS 69853-46-9 appears in our catalog under these names: Vesticarpan, Vesticarpan, 98.0%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 5mg, Get quote.
(6aS,11aS)-9-methoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene-3,10-diol (CAS 69853-46-9) is a chemical compound with the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. IUPAC name: (6aS,11aS)-9-methoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene-3,10-diol. InChIKey: JAAWOQQDCOFLRV-IAQYHMDHSA-N.
| Molecular formula | C16H14O5 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | (6aS,11aS)-9-methoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene-3,10-diol |
| InChIKey | JAAWOQQDCOFLRV-IAQYHMDHSA-N |
| SMILES | COC1=C(C2=C(C=C1)[C@H]3COC4=C([C@H]3O2)C=CC(=C4)O)O |
Computed by PubChem (NCBI)