Products 6989-38-4
CAS 6989-38-4 appears in our catalog under these names: Evodine, Evodine, 99.20%. Offered by: GLPBio, Biosynth, Chemat. Available pack sizes: 5mg, 100mg, 50mg, 1mg.
1-(4,8-dimethoxyfuro[2,3-b]quinolin-7-yl)oxy-3-methylbut-3-en-2-ol (CAS 6989-38-4) is a chemical compound with the molecular formula C18H19NO5 and a molecular weight of 329.3 g/mol. IUPAC name: 1-(4,8-dimethoxyfuro[2,3-b]quinolin-7-yl)oxy-3-methylbut-3-en-2-ol. InChIKey: LNJTUUHDKCPQAA-UHFFFAOYSA-N.
| Molecular formula | C18H19NO5 |
|---|---|
| Molecular weight | 329.3 g/mol |
| IUPAC name | 1-(4,8-dimethoxyfuro[2,3-b]quinolin-7-yl)oxy-3-methylbut-3-en-2-ol |
| InChIKey | LNJTUUHDKCPQAA-UHFFFAOYSA-N |
| SMILES | CC(=C)C(COC1=C(C2=C(C=C1)C(=C3C=COC3=N2)OC)OC)O |
Computed by PubChem (NCBI)