CAS 69951-03-7 appears in our catalog under these names: 2,3–Dichloro–4–nitroaniline, 2,3-Dichloro-4-nitroaniline 95%, 2,3-Dichloro-4-nitroaniline, 95%, 95%, 2,3-Dichloro-4-nitroaniline, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100mg, 250mg, 1g, 100g.
2,3-dichloro-4-nitroaniline (CAS 69951-03-7) is a chemical compound with the molecular formula C6H4Cl2N2O2 and a molecular weight of 207.01 g/mol. IUPAC name: 2,3-dichloro-4-nitroaniline. InChIKey: BOHXXTUGYSFUHK-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O2 |
|---|---|
| Molecular weight | 207.01 g/mol |
| IUPAC name | 2,3-dichloro-4-nitroaniline |
| InChIKey | BOHXXTUGYSFUHK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N)Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)