CAS 70253-89-3 is the registry number for 4-(Benzyloxy)benzene-1,2-diol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-phenylmethoxybenzene-1,2-diol (CAS 70253-89-3) is a chemical compound with the molecular formula C13H12O3 and a molecular weight of 216.23 g/mol. IUPAC name: 4-phenylmethoxybenzene-1,2-diol. InChIKey: VLLGNGJKOFKNEU-UHFFFAOYSA-N.
| Molecular formula | C13H12O3 |
|---|---|
| Molecular weight | 216.23 g/mol |
| IUPAC name | 4-phenylmethoxybenzene-1,2-diol |
| InChIKey | VLLGNGJKOFKNEU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2)O)O |
Computed by PubChem (NCBI)