Products 70390-94-2
CAS 70390-94-2 is the registry number for 2-(Chloromethyl)-5-phenyl-1,3,4-thiadiazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(chloromethyl)-5-phenyl-1,3,4-thiadiazole (CAS 70390-94-2) is a chemical compound with the molecular formula C9H7ClN2S and a molecular weight of 210.68 g/mol. IUPAC name: 2-(chloromethyl)-5-phenyl-1,3,4-thiadiazole. InChIKey: ZCKLQRJGNGUAER-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2S |
|---|---|
| Molecular weight | 210.68 g/mol |
| IUPAC name | 2-(chloromethyl)-5-phenyl-1,3,4-thiadiazole |
| InChIKey | ZCKLQRJGNGUAER-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(S2)CCl |
Computed by PubChem (NCBI)