Products 704-97-2

CAS 704-97-2 appears in our catalog under these names: 3-(2-FLUOROPHENYL)PROP-2-YNOIC ACID, 98%, 3-(2-Fluorophenyl)propiolic acid 95%, 3-(2-Fluorophenyl)propiolic acid, 95%, 95%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.

Structural formula: {0} (CAS {1})

3-(2-fluorophenyl)prop-2-ynoic acid (CAS 704-97-2) is a chemical compound with the molecular formula C9H5FO2 and a molecular weight of 164.13 g/mol. IUPAC name: 3-(2-fluorophenyl)prop-2-ynoic acid. InChIKey: STVAOWAAIBCKAN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5FO2
Molecular weight164.13 g/mol
IUPAC name3-(2-fluorophenyl)prop-2-ynoic acid
InChIKeySTVAOWAAIBCKAN-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C#CC(=O)O)F

Computed by PubChem (NCBI)