Products 70424-70-3
CAS 70424-70-3 appears in our catalog under these names: 2',3,4,5,5'-Pentachlorobiphenyl, PCB 124, ROTI®Star, 5 mg, glass, PCB 124, Concentration: 100 µg/ml Solvent: Isooctane. Offered by: Biosynth, Roth, HPC Standards. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 1x5ml.
1,2,3-trichloro-5-(2,5-dichlorophenyl)benzene (CAS 70424-70-3) is a chemical compound with the molecular formula C12H5Cl5 and a molecular weight of 326.4 g/mol. IUPAC name: 1,2,3-trichloro-5-(2,5-dichlorophenyl)benzene. InChIKey: PIVBPZFQXKMHBD-UHFFFAOYSA-N.
| Molecular formula | C12H5Cl5 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 1,2,3-trichloro-5-(2,5-dichlorophenyl)benzene |
| InChIKey | PIVBPZFQXKMHBD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C2=CC(=C(C(=C2)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
2,3',4',5,5'-Pentachlorobiphenyl, 2,3',4',5,5'-Pentachloro-1,1'-biphenyl, 2,3',4',5,5'-Pentachlorodiphenyl, 1,2,3-trichloro-5-(2,5-dichlorophenyl)benzene, 1,1'-Biphenyl, 2,3',4',5,5'-pentachloro-, Pcb No. 124, 1,1'-Biphenyl, 2',3,4,5,5'-Pentachloro-, PIVBPZFQXKMHBD-UHFFFAOYSA-N, 2,3,',4',5,5'-Pentachloro-1,1'-biphenyl, 2,3',4',5,5'-Pentachloro-1,1'-biphenyl #