CAS 70479-98-0 appears in our catalog under these names: L–Tyrosine–3,5–13C2, L-Tyrosine-3,5-13C2, 99%, 99%, L-Tyrosine-3,5-13C2, 99.43%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 1mg, 50 mg, 100 mg, 25 mg, 1 mg, 10 mg.
(2S)-2-amino-3-(4-hydroxy(3,5-13C2)cyclohexa-1,3,5-trien-1-yl)propanoic acid (CAS 70479-98-0) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 183.17 g/mol. IUPAC name: (2S)-2-amino-3-(4-hydroxy(3,5-13C2)cyclohexa-1,3,5-trien-1-yl)propanoic acid. InChIKey: OUYCCCASQSFEME-ALJHITAUSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 183.17 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-hydroxy(3,5-13C2)cyclohexa-1,3,5-trien-1-yl)propanoic acid |
| InChIKey | OUYCCCASQSFEME-ALJHITAUSA-N |
| SMILES | C1=[13CH]C(=[13CH]C=C1C[C@@H](C(=O)O)N)O |
Computed by PubChem (NCBI)