Products 70578-36-8
CAS 70578-36-8 is the registry number for Shizukanolide. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg.
(1S,7S,9S,10R,12S)-4,9-dimethyl-13-methylidene-6-oxatetracyclo[7.4.0.03,7.010,12]tridec-3-en-5-one (CAS 70578-36-8) is a chemical compound with the molecular formula C15H18O2 and a molecular weight of 230.30 g/mol. IUPAC name: (1S,7S,9S,10R,12S)-4,9-dimethyl-13-methylidene-6-oxatetracyclo[7.4.0.03,7.010,12]tridec-3-en-5-one. InChIKey: KCFCNCALMYTQMP-BJEMGHAFSA-N.
| Molecular formula | C15H18O2 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | (1S,7S,9S,10R,12S)-4,9-dimethyl-13-methylidene-6-oxatetracyclo[7.4.0.03,7.010,12]tridec-3-en-5-one |
| InChIKey | KCFCNCALMYTQMP-BJEMGHAFSA-N |
| SMILES | CC1=C2C[C@H]3C(=C)[C@H]4C[C@H]4[C@@]3(C[C@@H]2OC1=O)C |
Computed by PubChem (NCBI)