Products 70650-95-2
CAS 70650-95-2 appears in our catalog under these names: 4,2′:6′,4′′-Terpyridine, 95%, 4,2':6',4''-Terpyridine, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 10mg, 25mg, 50mg.
2,6-dipyridin-4-ylpyridine (CAS 70650-95-2) is a chemical compound with the molecular formula C15H11N3 and a molecular weight of 233.27 g/mol. IUPAC name: 2,6-dipyridin-4-ylpyridine. InChIKey: KUWORGFJPZWJPK-UHFFFAOYSA-N.
| Molecular formula | C15H11N3 |
|---|---|
| Molecular weight | 233.27 g/mol |
| IUPAC name | 2,6-dipyridin-4-ylpyridine |
| InChIKey | KUWORGFJPZWJPK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)C2=CC=NC=C2)C3=CC=NC=C3 |
Computed by PubChem (NCBI)