CAS 70681-20-8 is the registry number for rac Salsolinol Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 1g, 500mg, 5g.
1-methyl-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrochloride (CAS 70681-20-8) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: 1-methyl-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrochloride. InChIKey: WSVCGYSRZYNJMC-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | 1-methyl-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrochloride |
| InChIKey | WSVCGYSRZYNJMC-UHFFFAOYSA-N |
| SMILES | CC1C2=CC(=C(C=C2CCN1)O)O.Cl |
Computed by PubChem (NCBI)