Products 707-94-8

CAS 707-94-8 is the registry number for 4,5-Dimethyl 1H-1,2,3-triazole-4,5-dicarboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Dimethyl 2H-triazole-4,5-dicarboxylate (CAS 707-94-8) is a chemical compound with the molecular formula C6H7N3O4 and a molecular weight of 185.14 g/mol. IUPAC name: dimethyl 2H-triazole-4,5-dicarboxylate. InChIKey: HNGGSWPHMZXFNN-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7N3O4
Molecular weight185.14 g/mol
IUPAC namedimethyl 2H-triazole-4,5-dicarboxylate
InChIKeyHNGGSWPHMZXFNN-UHFFFAOYSA-N
SMILESCOC(=O)C1=NNN=C1C(=O)OC

Computed by PubChem (NCBI)