CAS 70758-34-8 is the registry number for Methyl 2-oxo-1,2-dihydroquinoline-5-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 2-oxo-1H-quinoline-5-carboxylate (CAS 70758-34-8) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: methyl 2-oxo-1H-quinoline-5-carboxylate. InChIKey: YOMAQGQZZWDMGK-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | methyl 2-oxo-1H-quinoline-5-carboxylate |
| InChIKey | YOMAQGQZZWDMGK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C=CC(=O)NC2=CC=C1 |
Computed by PubChem (NCBI)