CAS 7077-65-8 appears in our catalog under these names: 2-(4-Nitrophenyl)malononitrile 95%, 2-(4-Nitrophenyl)malononitrile, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(4-nitrophenyl)propanedinitrile (CAS 7077-65-8) is a chemical compound with the molecular formula C9H5N3O2 and a molecular weight of 187.15 g/mol. IUPAC name: 2-(4-nitrophenyl)propanedinitrile. InChIKey: HXEPLLFRQAVQQJ-UHFFFAOYSA-N.
| Molecular formula | C9H5N3O2 |
|---|---|
| Molecular weight | 187.15 g/mol |
| IUPAC name | 2-(4-nitrophenyl)propanedinitrile |
| InChIKey | HXEPLLFRQAVQQJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C#N)C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)