CAS 708-40-7 is the registry number for 1-Acetyl-6-chloro-1H-indazole, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
1-(6-chloroindazol-1-yl)ethanone (CAS 708-40-7) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 1-(6-chloroindazol-1-yl)ethanone. InChIKey: PBUGDGXAYHVXBR-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 1-(6-chloroindazol-1-yl)ethanone |
| InChIKey | PBUGDGXAYHVXBR-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C2=C(C=CC(=C2)Cl)C=N1 |
Computed by PubChem (NCBI)