CAS 70984-54-2 appears in our catalog under these names: 3-(Furan-2-yl)-2-(phenylformamido)prop-2-enoic acid, 3-(Furan-2-yl)-2-(phenylformamido)prop-2-enoic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 2,5g, 250mg, 5g.
2-benzamido-3-(furan-2-yl)prop-2-enoic acid (CAS 70984-54-2) is a chemical compound with the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. IUPAC name: 2-benzamido-3-(furan-2-yl)prop-2-enoic acid. InChIKey: XDKRSRYSRYRMTM-UHFFFAOYSA-N.
| Molecular formula | C14H11NO4 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 2-benzamido-3-(furan-2-yl)prop-2-enoic acid |
| InChIKey | XDKRSRYSRYRMTM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC(=CC2=CC=CO2)C(=O)O |
Computed by PubChem (NCBI)