Products 7101-95-3
CAS 7101-95-3 appears in our catalog under these names: 3-Bromo-6-nitroquinoline, 95%, 95%, 3-Bromo-6-nitroquinoline 95%, 3-Bromo-6-nitroquinoline, 95%, 3–Bromo–6–nitroquinoline. Offered by: Chemat, Ambeed, Fluorochem, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
3-bromo-6-nitroquinoline (CAS 7101-95-3) is a chemical compound with the molecular formula C9H5BrN2O2 and a molecular weight of 253.05 g/mol. IUPAC name: 3-bromo-6-nitroquinoline. InChIKey: XIGQUURJVUSYBF-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O2 |
|---|---|
| Molecular weight | 253.05 g/mol |
| IUPAC name | 3-bromo-6-nitroquinoline |
| InChIKey | XIGQUURJVUSYBF-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(C=C2C=C1[N+](=O)[O-])Br |
Computed by PubChem (NCBI)