CAS 71115-83-8 appears in our catalog under these names: FA-Phe-OH, 2-Furanacryloyl-L-phenylalanine, FA–Phe–OH, (S)-2-(3-(Furan-2-yl)acrylamido)-3-phenylpropanoic acid, 95%, 95%. Offered by: Creative Peptides, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100mg, 250mg.
(2S)-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-3-phenylpropanoic acid (CAS 71115-83-8) is a chemical compound with the molecular formula C16H15NO4 and a molecular weight of 285.29 g/mol. IUPAC name: (2S)-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-3-phenylpropanoic acid. InChIKey: QSMRHXUZHXEHBK-VFNNOXKTSA-N.
| Molecular formula | C16H15NO4 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | (2S)-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-3-phenylpropanoic acid |
| InChIKey | QSMRHXUZHXEHBK-VFNNOXKTSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)/C=C/C2=CC=CO2 |
Computed by PubChem (NCBI)