Products 71144-78-0
CAS 71144-78-0 is the registry number for (E)-3-Acetoxy-5-methoxystilbene. Offered by: MedChemExpress. Available pack sizes: Get quote.
[3-methoxy-5-[(E)-2-phenylethenyl]phenyl] acetate (CAS 71144-78-0) is a chemical compound with the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. IUPAC name: [3-methoxy-5-[(E)-2-phenylethenyl]phenyl] acetate. InChIKey: IJXZGYLGHOYXMS-CMDGGOBGSA-N.
| Molecular formula | C17H16O3 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | [3-methoxy-5-[(E)-2-phenylethenyl]phenyl] acetate |
| InChIKey | IJXZGYLGHOYXMS-CMDGGOBGSA-N |
| SMILES | CC(=O)OC1=CC(=CC(=C1)OC)/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)