Products 712-70-9
CAS 712-70-9 appears in our catalog under these names: 3-Fluoro-2-naphthoic acid, 98%, 3-Fluoronaphthalene-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-fluoronaphthalene-2-carboxylic acid (CAS 712-70-9) is a chemical compound with the molecular formula C11H7FO2 and a molecular weight of 190.17 g/mol. IUPAC name: 3-fluoronaphthalene-2-carboxylic acid. InChIKey: VDXLBIXGGFGMRQ-UHFFFAOYSA-N.
| Molecular formula | C11H7FO2 |
|---|---|
| Molecular weight | 190.17 g/mol |
| IUPAC name | 3-fluoronaphthalene-2-carboxylic acid |
| InChIKey | VDXLBIXGGFGMRQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C(=CC2=C1)C(=O)O)F |
Computed by PubChem (NCBI)