CAS 405196-33-0 appears in our catalog under these names: 8-Fluoro-1-naphthoic acid, 98%, 8-Fluoro-1-Naphthoic Acid, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 25mg, 50mg.
8-fluoronaphthalene-1-carboxylic acid (CAS 405196-33-0) is a chemical compound with the molecular formula C11H7FO2 and a molecular weight of 190.17 g/mol. IUPAC name: 8-fluoronaphthalene-1-carboxylic acid. InChIKey: BQLKWNFNGFWAMH-UHFFFAOYSA-N.
| Molecular formula | C11H7FO2 |
|---|---|
| Molecular weight | 190.17 g/mol |
| IUPAC name | 8-fluoronaphthalene-1-carboxylic acid |
| InChIKey | BQLKWNFNGFWAMH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(=O)O)C(=CC=C2)F |
Computed by PubChem (NCBI)