Products 1000386-62-8
CAS 1000386-62-8 is the registry number for 4-Fluoro-1-naphthalenol 1-Formate. Offered by: TRC. Available pack sizes: 5g.
(4-fluoronaphthalen-1-yl) formate (CAS 1000386-62-8) is a chemical compound with the molecular formula C11H7FO2 and a molecular weight of 190.17 g/mol. IUPAC name: (4-fluoronaphthalen-1-yl) formate. InChIKey: CDMLJUAAZQIQRF-UHFFFAOYSA-N.
| Molecular formula | C11H7FO2 |
|---|---|
| Molecular weight | 190.17 g/mol |
| IUPAC name | (4-fluoronaphthalen-1-yl) formate |
| InChIKey | CDMLJUAAZQIQRF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2F)OC=O |
Computed by PubChem (NCBI)
Synonyms:
4-Fluoro-1-naphthalenol 1-Formate