CAS 575-07-5 is the registry number for 3-Fluoronaphthalene-1-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-fluoronaphthalene-1-carboxylic acid (CAS 575-07-5) is a chemical compound with the molecular formula C11H7FO2 and a molecular weight of 190.17 g/mol. IUPAC name: 3-fluoronaphthalene-1-carboxylic acid. InChIKey: CWFWCCCXAANHRG-UHFFFAOYSA-N.
| Molecular formula | C11H7FO2 |
|---|---|
| Molecular weight | 190.17 g/mol |
| IUPAC name | 3-fluoronaphthalene-1-carboxylic acid |
| InChIKey | CWFWCCCXAANHRG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=C2C(=O)O)F |
Computed by PubChem (NCBI)