CAS 33342-18-6 is the registry number for 5-(3-Fluorophenyl)furan-2-carbaldehyde, 98%. Offered by: AmBeed. Available pack sizes: 10g.
5-(3-fluorophenyl)furan-2-carbaldehyde (CAS 33342-18-6) is a chemical compound with the molecular formula C11H7FO2 and a molecular weight of 190.17 g/mol. IUPAC name: 5-(3-fluorophenyl)furan-2-carbaldehyde. InChIKey: KAKGDPHEGDGAEW-UHFFFAOYSA-N.
| Molecular formula | C11H7FO2 |
|---|---|
| Molecular weight | 190.17 g/mol |
| IUPAC name | 5-(3-fluorophenyl)furan-2-carbaldehyde |
| InChIKey | KAKGDPHEGDGAEW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=CC=C(O2)C=O |
Computed by PubChem (NCBI)