CAS 71342-66-0 appears in our catalog under these names: 1-Ethyldihydro-6-imino-2,4,5(3H)-pyrimidinetrione 5-(O-Methyloxime), >95% (HPLC), Cymoxanil Metabolite IN-U3204. Offered by: TRC, HPC Standards. Available pack sizes: 100mg, 250mg, 50mg, 1x10mg.
(5E)-1-ethyl-6-imino-5-methoxyimino-1,3-diazinane-2,4-dione (CAS 71342-66-0) is a chemical compound with the molecular formula C7H10N4O3 and a molecular weight of 198.18 g/mol. IUPAC name: (5E)-1-ethyl-6-imino-5-methoxyimino-1,3-diazinane-2,4-dione. InChIKey: QHNYQVOBANAFAW-RCHRYLDCSA-N.
| Molecular formula | C7H10N4O3 |
|---|---|
| Molecular weight | 198.18 g/mol |
| IUPAC name | (5E)-1-ethyl-6-imino-5-methoxyimino-1,3-diazinane-2,4-dione |
| InChIKey | QHNYQVOBANAFAW-RCHRYLDCSA-N |
| SMILES | CCN1C(=N)/C(=N\OC)/C(=O)NC1=O |
Computed by PubChem (NCBI)