CAS 7163-25-9 appears in our catalog under these names: 3–Hydroxy–2–naphthoic Acid Ethyl Ester, Ethyl 3-Hydroxy-2-naphthoate, >98.0%(GC), Ethyl 3-hydroxy-2-naphthoate 98%, Ethyl 3-Hydroxy-2-naphthoate, 98%, 98%, Ethyl 3-hydroxy-2-naphthoate, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 250mg.
Ethyl 3-hydroxynaphthalene-2-carboxylate (CAS 7163-25-9) is a chemical compound with the molecular formula C13H12O3 and a molecular weight of 216.23 g/mol. IUPAC name: ethyl 3-hydroxynaphthalene-2-carboxylate. InChIKey: CVEOWBRXZJEZRQ-UHFFFAOYSA-N.
| Molecular formula | C13H12O3 |
|---|---|
| Molecular weight | 216.23 g/mol |
| IUPAC name | ethyl 3-hydroxynaphthalene-2-carboxylate |
| InChIKey | CVEOWBRXZJEZRQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=CC=CC=C2C=C1O |
Computed by PubChem (NCBI)