Products 716362-46-8

CAS 716362-46-8 is the registry number for 3-(METHYLCARBAMOYL)PYRAZINE-2-CARBOXYLIC ACID, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(methylcarbamoyl)pyrazine-2-carboxylic acid (CAS 716362-46-8) is a chemical compound with the molecular formula C7H7N3O3 and a molecular weight of 181.15 g/mol. IUPAC name: 3-(methylcarbamoyl)pyrazine-2-carboxylic acid. InChIKey: CIOYEZHRGBPXNC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7N3O3
Molecular weight181.15 g/mol
IUPAC name3-(methylcarbamoyl)pyrazine-2-carboxylic acid
InChIKeyCIOYEZHRGBPXNC-UHFFFAOYSA-N
SMILESCNC(=O)C1=NC=CN=C1C(=O)O

Computed by PubChem (NCBI)