Products 7170-50-5
CAS 7170-50-5 appears in our catalog under these names: 3-(3-Chloro-phenoxy)-propionic acid, 95%, 3–(3–Chlorophenoxy)propionic Acid, 3-(3-Chlorophenoxy)propionic Acid 98%, 3-(3-chlorophenoxy)propanoic acid, 98%, 98%, 3-(3-Chlorophenoxy)propanoic acid, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g.
3-(3-chlorophenoxy)propanoic acid (CAS 7170-50-5) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: 3-(3-chlorophenoxy)propanoic acid. InChIKey: QSGKVNYPPAQLDO-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 3-(3-chlorophenoxy)propanoic acid |
| InChIKey | QSGKVNYPPAQLDO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)OCCC(=O)O |
Computed by PubChem (NCBI)