CAS 71758-44-6 is the registry number for 2-((2-Chlorophenyl)amino)-benzaldehyde. Offered by: TRC. Available pack sizes: 25mg.
2-(2-chloroanilino)benzaldehyde (CAS 71758-44-6) is a chemical compound with the molecular formula C13H10ClNO and a molecular weight of 231.68 g/mol. IUPAC name: 2-(2-chloroanilino)benzaldehyde. InChIKey: DAAHPDZFLSFYPJ-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO |
|---|---|
| Molecular weight | 231.68 g/mol |
| IUPAC name | 2-(2-chloroanilino)benzaldehyde |
| InChIKey | DAAHPDZFLSFYPJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)NC2=CC=CC=C2Cl |
Computed by PubChem (NCBI)