CAS 71827-56-0 is the registry number for Clemeprol. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(4-chlorophenyl)-3-(dimethylamino)-1-phenylpropan-2-ol (CAS 71827-56-0) is a chemical compound with the molecular formula C17H20ClNO and a molecular weight of 289.8 g/mol. IUPAC name: 1-(4-chlorophenyl)-3-(dimethylamino)-1-phenylpropan-2-ol. InChIKey: YXOXPPZXGQCEEG-UHFFFAOYSA-N.
| Molecular formula | C17H20ClNO |
|---|---|
| Molecular weight | 289.8 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-3-(dimethylamino)-1-phenylpropan-2-ol |
| InChIKey | YXOXPPZXGQCEEG-UHFFFAOYSA-N |
| SMILES | CN(C)CC(C(C1=CC=CC=C1)C2=CC=C(C=C2)Cl)O |
Computed by PubChem (NCBI)