Products 718596-54-4
CAS 718596-54-4 appears in our catalog under these names: D-2,5-Dichlorophenylalanine, 95%, H-D-Phe(2,5-DiCl)-OH, 98+%, D-2,5-Dichlorophenylalanine, 95%, 95%, (R)-2-Amino-3-(2,5-dichlorophenyl)propanoic acid, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 100mg, 250mg, 500mg.
(2R)-2-amino-3-(2,5-dichlorophenyl)propanoic acid (CAS 718596-54-4) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: (2R)-2-amino-3-(2,5-dichlorophenyl)propanoic acid. InChIKey: SDKIMTATYJGPBJ-MRVPVSSYSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | (2R)-2-amino-3-(2,5-dichlorophenyl)propanoic acid |
| InChIKey | SDKIMTATYJGPBJ-MRVPVSSYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C[C@H](C(=O)O)N)Cl |
Computed by PubChem (NCBI)