CAS 71924-61-3 appears in our catalog under these names: 3–Fluoro–4,5–dimethoxybenzaldehyde, 3-Fluoro-4,5-Dimethoxybenzaldehyde, 3-Fluoro-4,5-dimethoxybenzaldehyde, 95%, 3-Fluoro-4,5-dimethoxybenzaldehyde, 95+%. Offered by: GLPBio, Biosynth, Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg, 0,5g, 50mg, 5g.
3-fluoro-4,5-dimethoxybenzaldehyde (CAS 71924-61-3) is a chemical compound with the molecular formula C9H9FO3 and a molecular weight of 184.16 g/mol. IUPAC name: 3-fluoro-4,5-dimethoxybenzaldehyde. InChIKey: KMWSZQLJNRHQES-UHFFFAOYSA-N.
| Molecular formula | C9H9FO3 |
|---|---|
| Molecular weight | 184.16 g/mol |
| IUPAC name | 3-fluoro-4,5-dimethoxybenzaldehyde |
| InChIKey | KMWSZQLJNRHQES-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C=O)F)OC |
Computed by PubChem (NCBI)