CAS 71952-99-3 appears in our catalog under these names: Fmoc-Gly-Ala-OH, 95%, (2S)-2-[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)acetamido]propanoic acid, ≥98.0%, ≥98.0%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 1g, 5g, 25g, 100g.
(2S)-2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]propanoic acid (CAS 71952-99-3) is a chemical compound with the molecular formula C20H20N2O5 and a molecular weight of 368.4 g/mol. IUPAC name: (2S)-2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]propanoic acid. InChIKey: KJFLZJBMRFRWIR-LBPRGKRZSA-N.
| Molecular formula | C20H20N2O5 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | (2S)-2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]propanoic acid |
| InChIKey | KJFLZJBMRFRWIR-LBPRGKRZSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)CNC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)