Products 71985-81-4

CAS 71985-81-4 appears in our catalog under these names: 2-(Piperidin-3-yl)acetic acid hydrochloride 95%, 2-(Piperidin-3-yl)acetic acid hydrochloride, 95%, 95%, 3-Piperidylacetic acid hydrochloride, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 10g.

Structural formula: {0} (CAS {1})

2-piperidin-3-ylacetic acid;hydrochloride (CAS 71985-81-4) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: 2-piperidin-3-ylacetic acid;hydrochloride. InChIKey: IMUCGEDHTPKPBM-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14ClNO2
Molecular weight179.64 g/mol
IUPAC name2-piperidin-3-ylacetic acid;hydrochloride
InChIKeyIMUCGEDHTPKPBM-UHFFFAOYSA-N
SMILESC1CC(CNC1)CC(=O)O.Cl

Computed by PubChem (NCBI)