Products 7201-79-8
CAS 7201-79-8 is the registry number for Otonecine (chloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
(1R,4R,8S)-7-(hydroxymethyl)-4-methyl-1,2,3,5-tetrahydropyrrolizin-4-ium-1,8-diol chloride (CAS 7201-79-8) is a chemical compound with the molecular formula C9H16ClNO3 and a molecular weight of 221.68 g/mol. IUPAC name: (1R,4R,8S)-7-(hydroxymethyl)-4-methyl-1,2,3,5-tetrahydropyrrolizin-4-ium-1,8-diol chloride. InChIKey: OOKWCHLTNRMNCY-RDTSDOJCSA-M.
| Molecular formula | C9H16ClNO3 |
|---|---|
| Molecular weight | 221.68 g/mol |
| IUPAC name | (1R,4R,8S)-7-(hydroxymethyl)-4-methyl-1,2,3,5-tetrahydropyrrolizin-4-ium-1,8-diol chloride |
| InChIKey | OOKWCHLTNRMNCY-RDTSDOJCSA-M |
| SMILES | C[N@+]12CC[C@H]([C@]1(C(=CC2)CO)O)O.[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
Othonecine chloride, Otonecine, chloride