Products 720689-28-1
CAS 720689-28-1 appears in our catalog under these names: 5-Chloro-2-(methylsulfonyl)benzoic acid 98%, 5-Chloro-2-(methylsulfonyl)benzoic Acid, 98%, 98%, 5-CHLORO-2-(METHYLSULFONYL)BENZOIC ACID, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-chloro-2-methylsulfonylbenzoic acid (CAS 720689-28-1) is a chemical compound with the molecular formula C8H7ClO4S and a molecular weight of 234.66 g/mol. IUPAC name: 5-chloro-2-methylsulfonylbenzoic acid. InChIKey: SPTLHSBGLBPOOY-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO4S |
|---|---|
| Molecular weight | 234.66 g/mol |
| IUPAC name | 5-chloro-2-methylsulfonylbenzoic acid |
| InChIKey | SPTLHSBGLBPOOY-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)