Products 721-54-0
CAS 721-54-0 appears in our catalog under these names: 2,4-Dimethyl-1-((3-methylphenyl)methyl)benzene, 95-<97%, 2,3',4-Trimethyldiphenylmethane. Offered by: Hoffman Fine Chemicals, TRC. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 750mg.
2,4-dimethyl-1-[(3-methylphenyl)methyl]benzene (CAS 721-54-0) is a chemical compound with the molecular formula C16H18 and a molecular weight of 210.31 g/mol. IUPAC name: 2,4-dimethyl-1-[(3-methylphenyl)methyl]benzene. InChIKey: CUOMESIAXPQWEM-UHFFFAOYSA-N.
| Molecular formula | C16H18 |
|---|---|
| Molecular weight | 210.31 g/mol |
| IUPAC name | 2,4-dimethyl-1-[(3-methylphenyl)methyl]benzene |
| InChIKey | CUOMESIAXPQWEM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)CC2=C(C=C(C=C2)C)C |
Computed by PubChem (NCBI)