Products 72155-46-5

CAS 72155-46-5 is the registry number for Boc-(3S,4S)-AHPPA-OH. Offered by: Creative Peptides. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpentanoic acid (CAS 72155-46-5) is a chemical compound with the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. IUPAC name: 3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpentanoic acid. InChIKey: SOSXJQKIIYOJPF-UHFFFAOYSA-N.

Identity
Molecular formulaC16H23NO5
Molecular weight309.36 g/mol
IUPAC name3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpentanoic acid
InChIKeySOSXJQKIIYOJPF-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC(CC1=CC=CC=C1)C(CC(=O)O)O

Computed by PubChem (NCBI)